C20H28IN5O3 — CID 111008094
1-ethyl-3-[2-(furan-2-yl)-2-pyrrolidin-1-ylethyl]-2-[(4-nitrophenyl)methyl]guanidine;hydroiodide (PubChem CID 111008094) has the molecular formula C20H28IN5O3 and a molecular weight of 513.38 g/mol. Its IUPAC name is 1-ethyl-3-[2-(furan-2-yl)-2-pyrrolidin-1-ylethyl]-2-[(4-nitrophenyl)methyl]guanidine;hydroiodide.
| Compound Name | 1-ethyl-3-[2-(furan-2-yl)-2-pyrrolidin-1-ylethyl]-2-[(4-nitrophenyl)methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111008094 |
| Molecular Formula | C20H28IN5O3 |
| Molecular Weight | 513.38 g/mol |
| Exact Mass | 513.12 |
| IUPAC Name | 1-ethyl-3-[2-(furan-2-yl)-2-pyrrolidin-1-ylethyl]-2-[(4-nitrophenyl)methyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\Cc1ccc([N+](=O)[O-])cc1)NCC(c1ccco1)N1CCCC1.I |
| InChI | InChI=1S/C20H27N5O3.HI/c1-2-21-20(22-14-16-7-9-17(10-8-16)25(26)27)23-15-18(19-6-5-13-28-19)24-11-3-4-12-24;/h5-10,13,18H,2-4,11-12,14-15H2,1H3,(H2,21,22,23);1H |
| InChIKey | BLYHOWQJCMHBSR-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 95.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.38 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|