C22H31IN4O3S — CID 109408702
1-(3-hydroxy-2-phenylpropyl)-2-methyl-3-[(4-pyrrolidin-1-ylsulfonylphenyl)methyl]guanidine;hydroiodide (PubChem CID 109408702) has the molecular formula C22H31IN4O3S and a molecular weight of 558.49 g/mol. Its IUPAC name is 1-(3-hydroxy-2-phenylpropyl)-2-methyl-3-[(4-pyrrolidin-1-ylsulfonylphenyl)methyl]guanidine;hydroiodide.
| Compound Name | 1-(3-hydroxy-2-phenylpropyl)-2-methyl-3-[(4-pyrrolidin-1-ylsulfonylphenyl)methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 109408702 |
| Molecular Formula | C22H31IN4O3S |
| Molecular Weight | 558.49 g/mol |
| Exact Mass | 558.12 |
| IUPAC Name | 1-(3-hydroxy-2-phenylpropyl)-2-methyl-3-[(4-pyrrolidin-1-ylsulfonylphenyl)methyl]guanidine;hydroiodide |
| SMILES | C/N=C(/NCc1ccc(S(=O)(=O)N2CCCC2)cc1)NCC(CO)c1ccccc1.I |
| InChI | InChI=1S/C22H30N4O3S.HI/c1-23-22(25-16-20(17-27)19-7-3-2-4-8-19)24-15-18-9-11-21(12-10-18)30(28,29)26-13-5-6-14-26;/h2-4,7-12,20,27H,5-6,13-17H2,1H3,(H2,23,24,25);1H |
| InChIKey | RAFOAGJTQBREEV-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 94.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.49 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|