C23H33IN4O3S — CID 109410532
1-[[1-(benzenesulfonyl)piperidin-4-yl]methyl]-3-(3-hydroxy-2-phenylpropyl)-2-methylguanidine;hydroiodide (PubChem CID 109410532) has the molecular formula C23H33IN4O3S and a molecular weight of 572.51 g/mol. Its IUPAC name is 1-[[1-(benzenesulfonyl)piperidin-4-yl]methyl]-3-(3-hydroxy-2-phenylpropyl)-2-methylguanidine;hydroiodide.
| Compound Name | 1-[[1-(benzenesulfonyl)piperidin-4-yl]methyl]-3-(3-hydroxy-2-phenylpropyl)-2-methylguanidine;hydroiodide |
|---|---|
| PubChem CID | 109410532 |
| Molecular Formula | C23H33IN4O3S |
| Molecular Weight | 572.51 g/mol |
| Exact Mass | 572.13 |
| IUPAC Name | 1-[[1-(benzenesulfonyl)piperidin-4-yl]methyl]-3-(3-hydroxy-2-phenylpropyl)-2-methylguanidine;hydroiodide |
| SMILES | C/N=C(/NCC1CCN(S(=O)(=O)c2ccccc2)CC1)NCC(CO)c1ccccc1.I |
| InChI | InChI=1S/C23H32N4O3S.HI/c1-24-23(26-17-21(18-28)20-8-4-2-5-9-20)25-16-19-12-14-27(15-13-19)31(29,30)22-10-6-3-7-11-22;/h2-11,19,21,28H,12-18H2,1H3,(H2,24,25,26);1H |
| InChIKey | MBFWIUNERMYHKF-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 94.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.51 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|