C21H27ClN4O2S — CID 111131066
1-[[1-(benzenesulfonyl)piperidin-4-yl]methyl]-3-[(4-chlorophenyl)methyl]-2-methylguanidine (PubChem CID 111131066) has the molecular formula C21H27ClN4O2S and a molecular weight of 434.99 g/mol. Its IUPAC name is 1-[[1-(benzenesulfonyl)piperidin-4-yl]methyl]-3-[(4-chlorophenyl)methyl]-2-methylguanidine.
| Compound Name | 1-[[1-(benzenesulfonyl)piperidin-4-yl]methyl]-3-[(4-chlorophenyl)methyl]-2-methylguanidine |
|---|---|
| PubChem CID | 111131066 |
| Molecular Formula | C21H27ClN4O2S |
| Molecular Weight | 434.99 g/mol |
| Exact Mass | 434.15 |
| IUPAC Name | 1-[[1-(benzenesulfonyl)piperidin-4-yl]methyl]-3-[(4-chlorophenyl)methyl]-2-methylguanidine |
| SMILES | C/N=C(\NCc1ccc(Cl)cc1)NCC1CCN(S(=O)(=O)c2ccccc2)CC1 |
| InChI | InChI=1S/C21H27ClN4O2S/c1-23-21(24-15-17-7-9-19(22)10-8-17)25-16-18-11-13-26(14-12-18)29(27,28)20-5-3-2-4-6-20/h2-10,18H,11-16H2,1H3,(H2,23,24,25) |
| InChIKey | YDWWSYWPJLSZCC-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 73.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.99 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|