C21H27N7O2S — CID 111014745
1-[[1-(benzenesulfonyl)piperidin-4-yl]methyl]-2-methyl-3-([1,2,4]triazolo[4,3-a]pyridin-3-ylmethyl)guanidine (PubChem CID 111014745) has the molecular formula C21H27N7O2S and a molecular weight of 441.56 g/mol. Its IUPAC name is 1-[[1-(benzenesulfonyl)piperidin-4-yl]methyl]-2-methyl-3-([1,2,4]triazolo[4,3-a]pyridin-3-ylmethyl)guanidine.
| Compound Name | 1-[[1-(benzenesulfonyl)piperidin-4-yl]methyl]-2-methyl-3-([1,2,4]triazolo[4,3-a]pyridin-3-ylmethyl)guanidine |
|---|---|
| PubChem CID | 111014745 |
| Molecular Formula | C21H27N7O2S |
| Molecular Weight | 441.56 g/mol |
| Exact Mass | 441.19 |
| IUPAC Name | 1-[[1-(benzenesulfonyl)piperidin-4-yl]methyl]-2-methyl-3-([1,2,4]triazolo[4,3-a]pyridin-3-ylmethyl)guanidine |
| SMILES | C/N=C(/NCc1nnc2ccccn12)NCC1CCN(S(=O)(=O)c2ccccc2)CC1 |
| InChI | InChI=1S/C21H27N7O2S/c1-22-21(24-16-20-26-25-19-9-5-6-12-28(19)20)23-15-17-10-13-27(14-11-17)31(29,30)18-7-3-2-4-8-18/h2-9,12,17H,10-11,13-16H2,1H3,(H2,22,23,24) |
| InChIKey | OWLAAWORPSTKBM-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 103.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.56 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|