C24H34N4O2S — CID 111171857
1-[[1-(benzenesulfonyl)piperidin-4-yl]methyl]-2-methyl-3-(4-phenylbutan-2-yl)guanidine (PubChem CID 111171857) has the molecular formula C24H34N4O2S and a molecular weight of 442.63 g/mol. Its IUPAC name is 1-[[1-(benzenesulfonyl)piperidin-4-yl]methyl]-2-methyl-3-(4-phenylbutan-2-yl)guanidine.
| Compound Name | 1-[[1-(benzenesulfonyl)piperidin-4-yl]methyl]-2-methyl-3-(4-phenylbutan-2-yl)guanidine |
|---|---|
| PubChem CID | 111171857 |
| Molecular Formula | C24H34N4O2S |
| Molecular Weight | 442.63 g/mol |
| Exact Mass | 442.24 |
| IUPAC Name | 1-[[1-(benzenesulfonyl)piperidin-4-yl]methyl]-2-methyl-3-(4-phenylbutan-2-yl)guanidine |
| SMILES | C/N=C(/NCC1CCN(S(=O)(=O)c2ccccc2)CC1)NC(C)CCc1ccccc1 |
| InChI | InChI=1S/C24H34N4O2S/c1-20(13-14-21-9-5-3-6-10-21)27-24(25-2)26-19-22-15-17-28(18-16-22)31(29,30)23-11-7-4-8-12-23/h3-12,20,22H,13-19H2,1-2H3,(H2,25,26,27) |
| InChIKey | JGMBPTYYIVXWJB-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 73.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.63 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|