C23H33IN4O2S — CID 111199535
1-[[1-(benzenesulfonyl)piperidin-4-yl]methyl]-2-methyl-3-(3-phenylpropyl)guanidine;hydroiodide (PubChem CID 111199535) has the molecular formula C23H33IN4O2S and a molecular weight of 556.51 g/mol. Its IUPAC name is 1-[[1-(benzenesulfonyl)piperidin-4-yl]methyl]-2-methyl-3-(3-phenylpropyl)guanidine;hydroiodide.
| Compound Name | 1-[[1-(benzenesulfonyl)piperidin-4-yl]methyl]-2-methyl-3-(3-phenylpropyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111199535 |
| Molecular Formula | C23H33IN4O2S |
| Molecular Weight | 556.51 g/mol |
| Exact Mass | 556.14 |
| IUPAC Name | 1-[[1-(benzenesulfonyl)piperidin-4-yl]methyl]-2-methyl-3-(3-phenylpropyl)guanidine;hydroiodide |
| SMILES | C/N=C(\NCCCc1ccccc1)NCC1CCN(S(=O)(=O)c2ccccc2)CC1.I |
| InChI | InChI=1S/C23H32N4O2S.HI/c1-24-23(25-16-8-11-20-9-4-2-5-10-20)26-19-21-14-17-27(18-15-21)30(28,29)22-12-6-3-7-13-22;/h2-7,9-10,12-13,21H,8,11,14-19H2,1H3,(H2,24,25,26);1H |
| InChIKey | RPDLZZQISVAHPJ-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 73.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.51 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|