C20H31F3N4O2S — CID 111559338
2-methyl-1-(5-phenylpentyl)-3-[[1-(trifluoromethylsulfonyl)piperidin-4-yl]methyl]guanidine (PubChem CID 111559338) has the molecular formula C20H31F3N4O2S and a molecular weight of 448.56 g/mol. Its IUPAC name is 2-methyl-1-(5-phenylpentyl)-3-[[1-(trifluoromethylsulfonyl)piperidin-4-yl]methyl]guanidine.
| Compound Name | 2-methyl-1-(5-phenylpentyl)-3-[[1-(trifluoromethylsulfonyl)piperidin-4-yl]methyl]guanidine |
|---|---|
| PubChem CID | 111559338 |
| Molecular Formula | C20H31F3N4O2S |
| Molecular Weight | 448.56 g/mol |
| Exact Mass | 448.21 |
| IUPAC Name | 2-methyl-1-(5-phenylpentyl)-3-[[1-(trifluoromethylsulfonyl)piperidin-4-yl]methyl]guanidine |
| SMILES | C/N=C(\NCCCCCc1ccccc1)NCC1CCN(S(=O)(=O)C(F)(F)F)CC1 |
| InChI | InChI=1S/C20H31F3N4O2S/c1-24-19(25-13-7-3-6-10-17-8-4-2-5-9-17)26-16-18-11-14-27(15-12-18)30(28,29)20(21,22)23/h2,4-5,8-9,18H,3,6-7,10-16H2,1H3,(H2,24,25,26) |
| InChIKey | GCGHVJCNGXPTRZ-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 73.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.56 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|