C22H36N4O2 — CID 111198792
tert-butyl 4-[[[N'-methyl-N-(3-phenylpropyl)carbamimidoyl]amino]methyl]piperidine-1-carboxylate (PubChem CID 111198792) has the molecular formula C22H36N4O2 and a molecular weight of 388.56 g/mol. Its IUPAC name is tert-butyl 4-[[[N'-methyl-N-(3-phenylpropyl)carbamimidoyl]amino]methyl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[[[N'-methyl-N-(3-phenylpropyl)carbamimidoyl]amino]methyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 111198792 |
| Molecular Formula | C22H36N4O2 |
| Molecular Weight | 388.56 g/mol |
| Exact Mass | 388.28 |
| IUPAC Name | tert-butyl 4-[[[N'-methyl-N-(3-phenylpropyl)carbamimidoyl]amino]methyl]piperidine-1-carboxylate |
| SMILES | C/N=C(\NCCCc1ccccc1)NCC1CCN(C(=O)OC(C)(C)C)CC1 |
| InChI | InChI=1S/C22H36N4O2/c1-22(2,3)28-21(27)26-15-12-19(13-16-26)17-25-20(23-4)24-14-8-11-18-9-6-5-7-10-18/h5-7,9-10,19H,8,11-17H2,1-4H3,(H2,23,24,25) |
| InChIKey | LVVZAMFDGXNLIF-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 65.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.56 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|