C21H34N4O2 — CID 111360873
tert-butyl 4-[[[N'-methyl-N-[(2-methylphenyl)methyl]carbamimidoyl]amino]methyl]piperidine-1-carboxylate (PubChem CID 111360873) has the molecular formula C21H34N4O2 and a molecular weight of 374.53 g/mol. Its IUPAC name is tert-butyl 4-[[[N'-methyl-N-[(2-methylphenyl)methyl]carbamimidoyl]amino]methyl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[[[N'-methyl-N-[(2-methylphenyl)methyl]carbamimidoyl]amino]methyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 111360873 |
| Molecular Formula | C21H34N4O2 |
| Molecular Weight | 374.53 g/mol |
| Exact Mass | 374.27 |
| IUPAC Name | tert-butyl 4-[[[N'-methyl-N-[(2-methylphenyl)methyl]carbamimidoyl]amino]methyl]piperidine-1-carboxylate |
| SMILES | C/N=C(\NCc1ccccc1C)NCC1CCN(C(=O)OC(C)(C)C)CC1 |
| InChI | InChI=1S/C21H34N4O2/c1-16-8-6-7-9-18(16)15-24-19(22-5)23-14-17-10-12-25(13-11-17)20(26)27-21(2,3)4/h6-9,17H,10-15H2,1-5H3,(H2,22,23,24) |
| InChIKey | HCYIDTNOUFYHGW-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 65.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.53 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|