C24H37N5O3 — CID 111414196
tert-butyl 4-[[[N'-methyl-N-[[4-(2-oxopyrrolidin-1-yl)phenyl]methyl]carbamimidoyl]amino]methyl]piperidine-1-carboxylate (PubChem CID 111414196) has the molecular formula C24H37N5O3 and a molecular weight of 443.59 g/mol. Its IUPAC name is tert-butyl 4-[[[N'-methyl-N-[[4-(2-oxopyrrolidin-1-yl)phenyl]methyl]carbamimidoyl]amino]methyl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[[[N'-methyl-N-[[4-(2-oxopyrrolidin-1-yl)phenyl]methyl]carbamimidoyl]amino]methyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 111414196 |
| Molecular Formula | C24H37N5O3 |
| Molecular Weight | 443.59 g/mol |
| Exact Mass | 443.29 |
| IUPAC Name | tert-butyl 4-[[[N'-methyl-N-[[4-(2-oxopyrrolidin-1-yl)phenyl]methyl]carbamimidoyl]amino]methyl]piperidine-1-carboxylate |
| SMILES | C/N=C(/NCc1ccc(N2CCCC2=O)cc1)NCC1CCN(C(=O)OC(C)(C)C)CC1 |
| InChI | InChI=1S/C24H37N5O3/c1-24(2,3)32-23(31)28-14-11-19(12-15-28)17-27-22(25-4)26-16-18-7-9-20(10-8-18)29-13-5-6-21(29)30/h7-10,19H,5-6,11-17H2,1-4H3,(H2,25,26,27) |
| InChIKey | GKARKTDZTLLXPV-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 86.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.59 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|