C23H37N5O3 — CID 111873615
tert-butyl 4-[[[N-[[4-(dimethylcarbamoyl)phenyl]methyl]-N'-methylcarbamimidoyl]amino]methyl]piperidine-1-carboxylate (PubChem CID 111873615) has the molecular formula C23H37N5O3 and a molecular weight of 431.58 g/mol. Its IUPAC name is tert-butyl 4-[[[N-[[4-(dimethylcarbamoyl)phenyl]methyl]-N'-methylcarbamimidoyl]amino]methyl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[[[N-[[4-(dimethylcarbamoyl)phenyl]methyl]-N'-methylcarbamimidoyl]amino]methyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 111873615 |
| Molecular Formula | C23H37N5O3 |
| Molecular Weight | 431.58 g/mol |
| Exact Mass | 431.29 |
| IUPAC Name | tert-butyl 4-[[[N-[[4-(dimethylcarbamoyl)phenyl]methyl]-N'-methylcarbamimidoyl]amino]methyl]piperidine-1-carboxylate |
| SMILES | C/N=C(/NCc1ccc(C(=O)N(C)C)cc1)NCC1CCN(C(=O)OC(C)(C)C)CC1 |
| InChI | InChI=1S/C23H37N5O3/c1-23(2,3)31-22(30)28-13-11-18(12-14-28)16-26-21(24-4)25-15-17-7-9-19(10-8-17)20(29)27(5)6/h7-10,18H,11-16H2,1-6H3,(H2,24,25,26) |
| InChIKey | MBYYLDNIOPRWSB-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 86.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.58 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|