C20H31ClN4O2 — CID 111131754
tert-butyl 4-[[[N-[(4-chlorophenyl)methyl]-N'-methylcarbamimidoyl]amino]methyl]piperidine-1-carboxylate (PubChem CID 111131754) has the molecular formula C20H31ClN4O2 and a molecular weight of 394.95 g/mol. Its IUPAC name is tert-butyl 4-[[[N-[(4-chlorophenyl)methyl]-N'-methylcarbamimidoyl]amino]methyl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[[[N-[(4-chlorophenyl)methyl]-N'-methylcarbamimidoyl]amino]methyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 111131754 |
| Molecular Formula | C20H31ClN4O2 |
| Molecular Weight | 394.95 g/mol |
| Exact Mass | 394.21 |
| IUPAC Name | tert-butyl 4-[[[N-[(4-chlorophenyl)methyl]-N'-methylcarbamimidoyl]amino]methyl]piperidine-1-carboxylate |
| SMILES | C/N=C(\NCc1ccc(Cl)cc1)NCC1CCN(C(=O)OC(C)(C)C)CC1 |
| InChI | InChI=1S/C20H31ClN4O2/c1-20(2,3)27-19(26)25-11-9-16(10-12-25)14-24-18(22-4)23-13-15-5-7-17(21)8-6-15/h5-8,16H,9-14H2,1-4H3,(H2,22,23,24) |
| InChIKey | XJEIHZZBMGZWLS-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 65.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.95 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|