C17H23ClN2O3 — CID 58748194
tert-butyl (3R)-3-[[(4-chlorobenzoyl)amino]methyl]pyrrolidine-1-carboxylate (PubChem CID 58748194) has the molecular formula C17H23ClN2O3 and a molecular weight of 338.84 g/mol. Its IUPAC name is tert-butyl (3R)-3-[[(4-chlorobenzoyl)amino]methyl]pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl (3R)-3-[[(4-chlorobenzoyl)amino]methyl]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 58748194 |
| Molecular Formula | C17H23ClN2O3 |
| Molecular Weight | 338.84 g/mol |
| Exact Mass | 338.14 |
| IUPAC Name | tert-butyl (3R)-3-[[(4-chlorobenzoyl)amino]methyl]pyrrolidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CC[C@H](CNC(=O)c2ccc(Cl)cc2)C1 |
| InChI | InChI=1S/C17H23ClN2O3/c1-17(2,3)23-16(22)20-9-8-12(11-20)10-19-15(21)13-4-6-14(18)7-5-13/h4-7,12H,8-11H2,1-3H3,(H,19,21)/t12-/m1/s1 |
| InChIKey | HCRZJAPTHHWDMJ-GFCCVEGCSA-N |
| XLogP | 3.33 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.84 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |