C24H39N5O3 — CID 111670656
tert-butyl 4-[[[N-[2-[3-(dimethylcarbamoyl)phenyl]ethyl]-N'-methylcarbamimidoyl]amino]methyl]piperidine-1-carboxylate (PubChem CID 111670656) has the molecular formula C24H39N5O3 and a molecular weight of 445.61 g/mol. Its IUPAC name is tert-butyl 4-[[[N-[2-[3-(dimethylcarbamoyl)phenyl]ethyl]-N'-methylcarbamimidoyl]amino]methyl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[[[N-[2-[3-(dimethylcarbamoyl)phenyl]ethyl]-N'-methylcarbamimidoyl]amino]methyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 111670656 |
| Molecular Formula | C24H39N5O3 |
| Molecular Weight | 445.61 g/mol |
| Exact Mass | 445.31 |
| IUPAC Name | tert-butyl 4-[[[N-[2-[3-(dimethylcarbamoyl)phenyl]ethyl]-N'-methylcarbamimidoyl]amino]methyl]piperidine-1-carboxylate |
| SMILES | C/N=C(\NCCc1cccc(C(=O)N(C)C)c1)NCC1CCN(C(=O)OC(C)(C)C)CC1 |
| InChI | InChI=1S/C24H39N5O3/c1-24(2,3)32-23(31)29-14-11-19(12-15-29)17-27-22(25-4)26-13-10-18-8-7-9-20(16-18)21(30)28(5)6/h7-9,16,19H,10-15,17H2,1-6H3,(H2,25,26,27) |
| InChIKey | JJUKFUVVQITNAA-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 86.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.61 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|