C18H27F3N4O3S — CID 109410023
1-(3-hydroxy-2-phenylpropyl)-2-methyl-3-[[1-(trifluoromethylsulfonyl)piperidin-4-yl]methyl]guanidine (PubChem CID 109410023) has the molecular formula C18H27F3N4O3S and a molecular weight of 436.50 g/mol. Its IUPAC name is 1-(3-hydroxy-2-phenylpropyl)-2-methyl-3-[[1-(trifluoromethylsulfonyl)piperidin-4-yl]methyl]guanidine.
| Compound Name | 1-(3-hydroxy-2-phenylpropyl)-2-methyl-3-[[1-(trifluoromethylsulfonyl)piperidin-4-yl]methyl]guanidine |
|---|---|
| PubChem CID | 109410023 |
| Molecular Formula | C18H27F3N4O3S |
| Molecular Weight | 436.50 g/mol |
| Exact Mass | 436.18 |
| IUPAC Name | 1-(3-hydroxy-2-phenylpropyl)-2-methyl-3-[[1-(trifluoromethylsulfonyl)piperidin-4-yl]methyl]guanidine |
| SMILES | C/N=C(/NCC1CCN(S(=O)(=O)C(F)(F)F)CC1)NCC(CO)c1ccccc1 |
| InChI | InChI=1S/C18H27F3N4O3S/c1-22-17(24-12-16(13-26)15-5-3-2-4-6-15)23-11-14-7-9-25(10-8-14)29(27,28)18(19,20)21/h2-6,14,16,26H,7-13H2,1H3,(H2,22,23,24) |
| InChIKey | NMXOMAVITANNCV-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 94.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.50 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|