C18H26F3IN6O2S — CID 111559339
2-methyl-1-[(1-methylbenzimidazol-2-yl)methyl]-3-[[1-(trifluoromethylsulfonyl)piperidin-4-yl]methyl]guanidine;hydroiodide (PubChem CID 111559339) has the molecular formula C18H26F3IN6O2S and a molecular weight of 574.41 g/mol. Its IUPAC name is 2-methyl-1-[(1-methylbenzimidazol-2-yl)methyl]-3-[[1-(trifluoromethylsulfonyl)piperidin-4-yl]methyl]guanidine;hydroiodide.
| Compound Name | 2-methyl-1-[(1-methylbenzimidazol-2-yl)methyl]-3-[[1-(trifluoromethylsulfonyl)piperidin-4-yl]methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111559339 |
| Molecular Formula | C18H26F3IN6O2S |
| Molecular Weight | 574.41 g/mol |
| Exact Mass | 574.08 |
| IUPAC Name | 2-methyl-1-[(1-methylbenzimidazol-2-yl)methyl]-3-[[1-(trifluoromethylsulfonyl)piperidin-4-yl]methyl]guanidine;hydroiodide |
| SMILES | C/N=C(/NCc1nc2ccccc2n1C)NCC1CCN(S(=O)(=O)C(F)(F)F)CC1.I |
| InChI | InChI=1S/C18H25F3N6O2S.HI/c1-22-17(24-12-16-25-14-5-3-4-6-15(14)26(16)2)23-11-13-7-9-27(10-8-13)30(28,29)18(19,20)21;/h3-6,13H,7-12H2,1-2H3,(H2,22,23,24);1H |
| InChIKey | DBBPHDLZVFGBIR-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 91.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.41 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|