C16H26N4O2S — CID 110953290
1-benzyl-2-methyl-3-[(1-methylsulfonylpiperidin-4-yl)methyl]guanidine (PubChem CID 110953290) has the molecular formula C16H26N4O2S and a molecular weight of 338.48 g/mol. Its IUPAC name is 1-benzyl-2-methyl-3-[(1-methylsulfonylpiperidin-4-yl)methyl]guanidine.
| Compound Name | 1-benzyl-2-methyl-3-[(1-methylsulfonylpiperidin-4-yl)methyl]guanidine |
|---|---|
| PubChem CID | 110953290 |
| Molecular Formula | C16H26N4O2S |
| Molecular Weight | 338.48 g/mol |
| Exact Mass | 338.18 |
| IUPAC Name | 1-benzyl-2-methyl-3-[(1-methylsulfonylpiperidin-4-yl)methyl]guanidine |
| SMILES | C/N=C(\NCc1ccccc1)NCC1CCN(S(C)(=O)=O)CC1 |
| InChI | InChI=1S/C16H26N4O2S/c1-17-16(18-12-14-6-4-3-5-7-14)19-13-15-8-10-20(11-9-15)23(2,21)22/h3-7,15H,8-13H2,1-2H3,(H2,17,18,19) |
| InChIKey | KBTYBYRUPRBIKC-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 73.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.48 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|