C18H28N4S — CID 110992223
1-cyclopentyl-2-methyl-3-[(4-thiomorpholin-4-ylphenyl)methyl]guanidine (PubChem CID 110992223) has the molecular formula C18H28N4S and a molecular weight of 332.52 g/mol. Its IUPAC name is 1-cyclopentyl-2-methyl-3-[(4-thiomorpholin-4-ylphenyl)methyl]guanidine.
| Compound Name | 1-cyclopentyl-2-methyl-3-[(4-thiomorpholin-4-ylphenyl)methyl]guanidine |
|---|---|
| PubChem CID | 110992223 |
| Molecular Formula | C18H28N4S |
| Molecular Weight | 332.52 g/mol |
| Exact Mass | 332.20 |
| IUPAC Name | 1-cyclopentyl-2-methyl-3-[(4-thiomorpholin-4-ylphenyl)methyl]guanidine |
| SMILES | C/N=C(\NCc1ccc(N2CCSCC2)cc1)NC1CCCC1 |
| InChI | InChI=1S/C18H28N4S/c1-19-18(21-16-4-2-3-5-16)20-14-15-6-8-17(9-7-15)22-10-12-23-13-11-22/h6-9,16H,2-5,10-14H2,1H3,(H2,19,20,21) |
| InChIKey | SBGDZDHAGZLWGN-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 39.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.52 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|