C19H30N4S — CID 110992225
1-cyclopentyl-3-ethyl-2-[(4-thiomorpholin-4-ylphenyl)methyl]guanidine (PubChem CID 110992225) has the molecular formula C19H30N4S and a molecular weight of 346.54 g/mol. Its IUPAC name is 1-cyclopentyl-3-ethyl-2-[(4-thiomorpholin-4-ylphenyl)methyl]guanidine.
| Compound Name | 1-cyclopentyl-3-ethyl-2-[(4-thiomorpholin-4-ylphenyl)methyl]guanidine |
|---|---|
| PubChem CID | 110992225 |
| Molecular Formula | C19H30N4S |
| Molecular Weight | 346.54 g/mol |
| Exact Mass | 346.22 |
| IUPAC Name | 1-cyclopentyl-3-ethyl-2-[(4-thiomorpholin-4-ylphenyl)methyl]guanidine |
| SMILES | CCN/C(=N\Cc1ccc(N2CCSCC2)cc1)NC1CCCC1 |
| InChI | InChI=1S/C19H30N4S/c1-2-20-19(22-17-5-3-4-6-17)21-15-16-7-9-18(10-8-16)23-11-13-24-14-12-23/h7-10,17H,2-6,11-15H2,1H3,(H2,20,21,22) |
| InChIKey | UWAFFAAOZRVNNX-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 39.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.54 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|