C20H30IN5S2 — CID 111535277
1-ethyl-3-[(5-ethyl-1,3-thiazol-2-yl)methyl]-2-[(4-thiomorpholin-4-ylphenyl)methyl]guanidine;hydroiodide (PubChem CID 111535277) has the molecular formula C20H30IN5S2 and a molecular weight of 531.53 g/mol. Its IUPAC name is 1-ethyl-3-[(5-ethyl-1,3-thiazol-2-yl)methyl]-2-[(4-thiomorpholin-4-ylphenyl)methyl]guanidine;hydroiodide.
| Compound Name | 1-ethyl-3-[(5-ethyl-1,3-thiazol-2-yl)methyl]-2-[(4-thiomorpholin-4-ylphenyl)methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111535277 |
| Molecular Formula | C20H30IN5S2 |
| Molecular Weight | 531.53 g/mol |
| Exact Mass | 531.10 |
| IUPAC Name | 1-ethyl-3-[(5-ethyl-1,3-thiazol-2-yl)methyl]-2-[(4-thiomorpholin-4-ylphenyl)methyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\Cc1ccc(N2CCSCC2)cc1)NCc1ncc(CC)s1.I |
| InChI | InChI=1S/C20H29N5S2.HI/c1-3-18-14-22-19(27-18)15-24-20(21-4-2)23-13-16-5-7-17(8-6-16)25-9-11-26-12-10-25;/h5-8,14H,3-4,9-13,15H2,1-2H3,(H2,21,23,24);1H |
| InChIKey | ZDYYOJZIOSCMOA-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 52.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.53 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|