C19H30N6S — CID 111535184
2-[[6-(diethylamino)-3-pyridinyl]methyl]-1-ethyl-3-[(5-ethyl-1,3-thiazol-2-yl)methyl]guanidine (PubChem CID 111535184) has the molecular formula C19H30N6S and a molecular weight of 374.56 g/mol. Its IUPAC name is 2-[[6-(diethylamino)-3-pyridinyl]methyl]-1-ethyl-3-[(5-ethyl-1,3-thiazol-2-yl)methyl]guanidine.
| Compound Name | 2-[[6-(diethylamino)-3-pyridinyl]methyl]-1-ethyl-3-[(5-ethyl-1,3-thiazol-2-yl)methyl]guanidine |
|---|---|
| PubChem CID | 111535184 |
| Molecular Formula | C19H30N6S |
| Molecular Weight | 374.56 g/mol |
| Exact Mass | 374.23 |
| IUPAC Name | 2-[[6-(diethylamino)-3-pyridinyl]methyl]-1-ethyl-3-[(5-ethyl-1,3-thiazol-2-yl)methyl]guanidine |
| SMILES | CCN/C(=N\Cc1ccc(N(CC)CC)nc1)NCc1ncc(CC)s1 |
| InChI | InChI=1S/C19H30N6S/c1-5-16-13-22-18(26-16)14-24-19(20-6-2)23-12-15-9-10-17(21-11-15)25(7-3)8-4/h9-11,13H,5-8,12,14H2,1-4H3,(H2,20,23,24) |
| InChIKey | RSQHSNSBDGICSD-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 65.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.56 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|