C22H29F2N5 — CID 111901729
1-[(2,5-difluorophenyl)methyl]-2-methyl-3-[[4-[(4-methylpiperazin-1-yl)methyl]phenyl]methyl]guanidine (PubChem CID 111901729) has the molecular formula C22H29F2N5 and a molecular weight of 401.51 g/mol. Its IUPAC name is 1-[(2,5-difluorophenyl)methyl]-2-methyl-3-[[4-[(4-methylpiperazin-1-yl)methyl]phenyl]methyl]guanidine.
| Compound Name | 1-[(2,5-difluorophenyl)methyl]-2-methyl-3-[[4-[(4-methylpiperazin-1-yl)methyl]phenyl]methyl]guanidine |
|---|---|
| PubChem CID | 111901729 |
| Molecular Formula | C22H29F2N5 |
| Molecular Weight | 401.51 g/mol |
| Exact Mass | 401.24 |
| IUPAC Name | 1-[(2,5-difluorophenyl)methyl]-2-methyl-3-[[4-[(4-methylpiperazin-1-yl)methyl]phenyl]methyl]guanidine |
| SMILES | C/N=C(\NCc1ccc(CN2CCN(C)CC2)cc1)NCc1cc(F)ccc1F |
| InChI | InChI=1S/C22H29F2N5/c1-25-22(27-15-19-13-20(23)7-8-21(19)24)26-14-17-3-5-18(6-4-17)16-29-11-9-28(2)10-12-29/h3-8,13H,9-12,14-16H2,1-2H3,(H2,25,26,27) |
| InChIKey | XTPZLRBJNWVPPV-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 42.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.51 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|