C23H32ClN5 — CID 111131824
1-[(4-chlorophenyl)methyl]-2-methyl-3-[[4-[(4-methyl-1,4-diazepan-1-yl)methyl]phenyl]methyl]guanidine (PubChem CID 111131824) has the molecular formula C23H32ClN5 and a molecular weight of 414.00 g/mol. Its IUPAC name is 1-[(4-chlorophenyl)methyl]-2-methyl-3-[[4-[(4-methyl-1,4-diazepan-1-yl)methyl]phenyl]methyl]guanidine.
| Compound Name | 1-[(4-chlorophenyl)methyl]-2-methyl-3-[[4-[(4-methyl-1,4-diazepan-1-yl)methyl]phenyl]methyl]guanidine |
|---|---|
| PubChem CID | 111131824 |
| Molecular Formula | C23H32ClN5 |
| Molecular Weight | 414.00 g/mol |
| Exact Mass | 413.23 |
| IUPAC Name | 1-[(4-chlorophenyl)methyl]-2-methyl-3-[[4-[(4-methyl-1,4-diazepan-1-yl)methyl]phenyl]methyl]guanidine |
| SMILES | C/N=C(\NCc1ccc(Cl)cc1)NCc1ccc(CN2CCCN(C)CC2)cc1 |
| InChI | InChI=1S/C23H32ClN5/c1-25-23(27-17-20-8-10-22(24)11-9-20)26-16-19-4-6-21(7-5-19)18-29-13-3-12-28(2)14-15-29/h4-11H,3,12-18H2,1-2H3,(H2,25,26,27) |
| InChIKey | XFLUWFLHEBSWRY-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 42.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.00 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|