C23H30F3N5 — CID 111420161
2-methyl-1-[[4-[(4-methylpiperazin-1-yl)methyl]phenyl]methyl]-3-[[4-(trifluoromethyl)phenyl]methyl]guanidine (PubChem CID 111420161) has the molecular formula C23H30F3N5 and a molecular weight of 433.52 g/mol. Its IUPAC name is 2-methyl-1-[[4-[(4-methylpiperazin-1-yl)methyl]phenyl]methyl]-3-[[4-(trifluoromethyl)phenyl]methyl]guanidine.
| Compound Name | 2-methyl-1-[[4-[(4-methylpiperazin-1-yl)methyl]phenyl]methyl]-3-[[4-(trifluoromethyl)phenyl]methyl]guanidine |
|---|---|
| PubChem CID | 111420161 |
| Molecular Formula | C23H30F3N5 |
| Molecular Weight | 433.52 g/mol |
| Exact Mass | 433.25 |
| IUPAC Name | 2-methyl-1-[[4-[(4-methylpiperazin-1-yl)methyl]phenyl]methyl]-3-[[4-(trifluoromethyl)phenyl]methyl]guanidine |
| SMILES | C/N=C(\NCc1ccc(CN2CCN(C)CC2)cc1)NCc1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C23H30F3N5/c1-27-22(29-16-19-7-9-21(10-8-19)23(24,25)26)28-15-18-3-5-20(6-4-18)17-31-13-11-30(2)12-14-31/h3-10H,11-17H2,1-2H3,(H2,27,28,29) |
| InChIKey | AEGJGNJZBFPCRX-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 42.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.52 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|