C21H37N5O — CID 111222359
1-(3-ethoxypropyl)-2-methyl-3-[[4-[(4-methyl-1,4-diazepan-1-yl)methyl]phenyl]methyl]guanidine (PubChem CID 111222359) has the molecular formula C21H37N5O and a molecular weight of 375.56 g/mol. Its IUPAC name is 1-(3-ethoxypropyl)-2-methyl-3-[[4-[(4-methyl-1,4-diazepan-1-yl)methyl]phenyl]methyl]guanidine.
| Compound Name | 1-(3-ethoxypropyl)-2-methyl-3-[[4-[(4-methyl-1,4-diazepan-1-yl)methyl]phenyl]methyl]guanidine |
|---|---|
| PubChem CID | 111222359 |
| Molecular Formula | C21H37N5O |
| Molecular Weight | 375.56 g/mol |
| Exact Mass | 375.30 |
| IUPAC Name | 1-(3-ethoxypropyl)-2-methyl-3-[[4-[(4-methyl-1,4-diazepan-1-yl)methyl]phenyl]methyl]guanidine |
| SMILES | CCOCCCN/C(=N\C)NCc1ccc(CN2CCCN(C)CC2)cc1 |
| InChI | InChI=1S/C21H37N5O/c1-4-27-16-5-11-23-21(22-2)24-17-19-7-9-20(10-8-19)18-26-13-6-12-25(3)14-15-26/h7-10H,4-6,11-18H2,1-3H3,(H2,22,23,24) |
| InChIKey | HJGYQWARDAQHRD-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 52.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.56 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|