C15H23F3N4 — CID 109474497
2-[[4-(dimethylamino)phenyl]methyl]-1-ethyl-3-(3,3,3-trifluoropropyl)guanidine (PubChem CID 109474497) has the molecular formula C15H23F3N4 and a molecular weight of 316.37 g/mol. Its IUPAC name is 2-[[4-(dimethylamino)phenyl]methyl]-1-ethyl-3-(3,3,3-trifluoropropyl)guanidine.
| Compound Name | 2-[[4-(dimethylamino)phenyl]methyl]-1-ethyl-3-(3,3,3-trifluoropropyl)guanidine |
|---|---|
| PubChem CID | 109474497 |
| Molecular Formula | C15H23F3N4 |
| Molecular Weight | 316.37 g/mol |
| Exact Mass | 316.19 |
| IUPAC Name | 2-[[4-(dimethylamino)phenyl]methyl]-1-ethyl-3-(3,3,3-trifluoropropyl)guanidine |
| SMILES | CCN/C(=N\Cc1ccc(N(C)C)cc1)NCCC(F)(F)F |
| InChI | InChI=1S/C15H23F3N4/c1-4-19-14(20-10-9-15(16,17)18)21-11-12-5-7-13(8-6-12)22(2)3/h5-8H,4,9-11H2,1-3H3,(H2,19,20,21) |
| InChIKey | MNTCREKLUWTOMR-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 39.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.37 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|