C17H25F3N4O — CID 109473577
N-[4-[[[ethylamino-(3,3,3-trifluoropropylamino)methylidene]amino]methyl]phenyl]-2-methylpropanamide (PubChem CID 109473577) has the molecular formula C17H25F3N4O and a molecular weight of 358.41 g/mol. Its IUPAC name is N-[4-[[[ethylamino-(3,3,3-trifluoropropylamino)methylidene]amino]methyl]phenyl]-2-methylpropanamide.
| Compound Name | N-[4-[[[ethylamino-(3,3,3-trifluoropropylamino)methylidene]amino]methyl]phenyl]-2-methylpropanamide |
|---|---|
| PubChem CID | 109473577 |
| Molecular Formula | C17H25F3N4O |
| Molecular Weight | 358.41 g/mol |
| Exact Mass | 358.20 |
| IUPAC Name | N-[4-[[[ethylamino-(3,3,3-trifluoropropylamino)methylidene]amino]methyl]phenyl]-2-methylpropanamide |
| SMILES | CCN/C(=N\Cc1ccc(NC(=O)C(C)C)cc1)NCCC(F)(F)F |
| InChI | InChI=1S/C17H25F3N4O/c1-4-21-16(22-10-9-17(18,19)20)23-11-13-5-7-14(8-6-13)24-15(25)12(2)3/h5-8,12H,4,9-11H2,1-3H3,(H,24,25)(H2,21,22,23) |
| InChIKey | GHWFHJYKQJETFQ-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 65.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.41 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|