C15H20F2N2O2 — CID 113079908
tert-butyl 4-(2,4-difluorophenyl)piperazine-1-carboxylate (PubChem CID 113079908) has the molecular formula C15H20F2N2O2 and a molecular weight of 298.33 g/mol. Its IUPAC name is tert-butyl 4-(2,4-difluorophenyl)piperazine-1-carboxylate.
| Compound Name | tert-butyl 4-(2,4-difluorophenyl)piperazine-1-carboxylate |
|---|---|
| PubChem CID | 113079908 |
| Molecular Formula | C15H20F2N2O2 |
| Molecular Weight | 298.33 g/mol |
| Exact Mass | 298.15 |
| IUPAC Name | tert-butyl 4-(2,4-difluorophenyl)piperazine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCN(c2ccc(F)cc2F)CC1 |
| InChI | InChI=1S/C15H20F2N2O2/c1-15(2,3)21-14(20)19-8-6-18(7-9-19)13-5-4-11(16)10-12(13)17/h4-5,10H,6-9H2,1-3H3 |
| InChIKey | SJTJHTXEEGJDLC-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.33 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |