C17H23FN2O4 — CID 164879195
tert-butyl 4-(2-fluoro-5-methoxycarbonylphenyl)piperazine-1-carboxylate (PubChem CID 164879195) has the molecular formula C17H23FN2O4 and a molecular weight of 338.38 g/mol. Its IUPAC name is tert-butyl 4-(2-fluoro-5-methoxycarbonylphenyl)piperazine-1-carboxylate.
| Compound Name | tert-butyl 4-(2-fluoro-5-methoxycarbonylphenyl)piperazine-1-carboxylate |
|---|---|
| PubChem CID | 164879195 |
| Molecular Formula | C17H23FN2O4 |
| Molecular Weight | 338.38 g/mol |
| Exact Mass | 338.16 |
| IUPAC Name | tert-butyl 4-(2-fluoro-5-methoxycarbonylphenyl)piperazine-1-carboxylate |
| SMILES | COC(=O)c1ccc(F)c(N2CCN(C(=O)OC(C)(C)C)CC2)c1 |
| InChI | InChI=1S/C17H23FN2O4/c1-17(2,3)24-16(22)20-9-7-19(8-10-20)14-11-12(15(21)23-4)5-6-13(14)18/h5-6,11H,7-10H2,1-4H3 |
| InChIKey | GZOIPOPNOXOKRJ-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.38 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |