C21H31FN2O6 — CID 142327290
dimethyl 3-fluoro-5-[4-[(2-methylpropan-2-yl)oxycarbonyl]piperazin-1-yl]benzene-1,2-dicarboxylate;ethane (PubChem CID 142327290) has the molecular formula C21H31FN2O6 and a molecular weight of 426.49 g/mol. Its IUPAC name is dimethyl 3-fluoro-5-[4-[(2-methylpropan-2-yl)oxycarbonyl]piperazin-1-yl]benzene-1,2-dicarboxylate;ethane.
| Compound Name | dimethyl 3-fluoro-5-[4-[(2-methylpropan-2-yl)oxycarbonyl]piperazin-1-yl]benzene-1,2-dicarboxylate;ethane |
|---|---|
| PubChem CID | 142327290 |
| Molecular Formula | C21H31FN2O6 |
| Molecular Weight | 426.49 g/mol |
| Exact Mass | 426.22 |
| IUPAC Name | dimethyl 3-fluoro-5-[4-[(2-methylpropan-2-yl)oxycarbonyl]piperazin-1-yl]benzene-1,2-dicarboxylate;ethane |
| SMILES | CC.COC(=O)c1cc(N2CCN(C(=O)OC(C)(C)C)CC2)cc(F)c1C(=O)OC |
| InChI | InChI=1S/C19H25FN2O6.C2H6/c1-19(2,3)28-18(25)22-8-6-21(7-9-22)12-10-13(16(23)26-4)15(14(20)11-12)17(24)27-5;1-2/h10-11H,6-9H2,1-5H3;1-2H3 |
| InChIKey | ONYMXWZUOQTULZ-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 85.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.49 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|