C16H23FN4O3 — CID 166021875
tert-butyl 4-[5-fluoro-6-(methylcarbamoyl)-3-pyridinyl]piperazine-1-carboxylate (PubChem CID 166021875) has the molecular formula C16H23FN4O3 and a molecular weight of 338.38 g/mol. Its IUPAC name is tert-butyl 4-[5-fluoro-6-(methylcarbamoyl)-3-pyridinyl]piperazine-1-carboxylate.
| Compound Name | tert-butyl 4-[5-fluoro-6-(methylcarbamoyl)-3-pyridinyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 166021875 |
| Molecular Formula | C16H23FN4O3 |
| Molecular Weight | 338.38 g/mol |
| Exact Mass | 338.18 |
| IUPAC Name | tert-butyl 4-[5-fluoro-6-(methylcarbamoyl)-3-pyridinyl]piperazine-1-carboxylate |
| SMILES | CNC(=O)c1ncc(N2CCN(C(=O)OC(C)(C)C)CC2)cc1F |
| InChI | InChI=1S/C16H23FN4O3/c1-16(2,3)24-15(23)21-7-5-20(6-8-21)11-9-12(17)13(19-10-11)14(22)18-4/h9-10H,5-8H2,1-4H3,(H,18,22) |
| InChIKey | QDVKGGIZWQNXFO-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 74.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.38 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |