C14H22N4O4S — CID 168896507
tert-butyl 4-(2-methylsulfonylpyrimidin-5-yl)piperazine-1-carboxylate (PubChem CID 168896507) has the molecular formula C14H22N4O4S and a molecular weight of 342.42 g/mol. Its IUPAC name is tert-butyl 4-(2-methylsulfonylpyrimidin-5-yl)piperazine-1-carboxylate.
| Compound Name | tert-butyl 4-(2-methylsulfonylpyrimidin-5-yl)piperazine-1-carboxylate |
|---|---|
| PubChem CID | 168896507 |
| Molecular Formula | C14H22N4O4S |
| Molecular Weight | 342.42 g/mol |
| Exact Mass | 342.14 |
| IUPAC Name | tert-butyl 4-(2-methylsulfonylpyrimidin-5-yl)piperazine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCN(c2cnc(S(C)(=O)=O)nc2)CC1 |
| InChI | InChI=1S/C14H22N4O4S/c1-14(2,3)22-13(19)18-7-5-17(6-8-18)11-9-15-12(16-10-11)23(4,20)21/h9-10H,5-8H2,1-4H3 |
| InChIKey | OEVPWBVEEOZZTE-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 92.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.42 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |