C13H21N5O2 — CID 59464319
tert-butyl 4-(5-aminopyrimidin-2-yl)piperazine-1-carboxylate (PubChem CID 59464319) has the molecular formula C13H21N5O2 and a molecular weight of 279.34 g/mol. Its IUPAC name is tert-butyl 4-(5-aminopyrimidin-2-yl)piperazine-1-carboxylate.
| Compound Name | tert-butyl 4-(5-aminopyrimidin-2-yl)piperazine-1-carboxylate |
|---|---|
| PubChem CID | 59464319 |
| Molecular Formula | C13H21N5O2 |
| Molecular Weight | 279.34 g/mol |
| Exact Mass | 279.17 |
| IUPAC Name | tert-butyl 4-(5-aminopyrimidin-2-yl)piperazine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCN(c2ncc(N)cn2)CC1 |
| InChI | InChI=1S/C13H21N5O2/c1-13(2,3)20-12(19)18-6-4-17(5-7-18)11-15-8-10(14)9-16-11/h8-9H,4-7,14H2,1-3H3 |
| InChIKey | UOFXCDLVMBOPFE-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 84.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.34 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |