C19H29FN4O2 — CID 24959968
tert-butyl 4-[1-(5-fluoropyrimidin-2-yl)piperidin-4-yl]piperidine-1-carboxylate (PubChem CID 24959968) has the molecular formula C19H29FN4O2 and a molecular weight of 364.47 g/mol. Its IUPAC name is tert-butyl 4-[1-(5-fluoropyrimidin-2-yl)piperidin-4-yl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[1-(5-fluoropyrimidin-2-yl)piperidin-4-yl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 24959968 |
| Molecular Formula | C19H29FN4O2 |
| Molecular Weight | 364.47 g/mol |
| Exact Mass | 364.23 |
| IUPAC Name | tert-butyl 4-[1-(5-fluoropyrimidin-2-yl)piperidin-4-yl]piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(C2CCN(c3ncc(F)cn3)CC2)CC1 |
| InChI | InChI=1S/C19H29FN4O2/c1-19(2,3)26-18(25)24-10-6-15(7-11-24)14-4-8-23(9-5-14)17-21-12-16(20)13-22-17/h12-15H,4-11H2,1-3H3 |
| InChIKey | HYSWWXCACUSPMW-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 58.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.47 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |