C23H38FN3O2 — CID 170749699
tert-butyl 4-[1-(4-amino-2-fluorophenyl)piperidin-4-yl]piperidine-1-carboxylate;ethane (PubChem CID 170749699) has the molecular formula C23H38FN3O2 and a molecular weight of 407.57 g/mol. Its IUPAC name is tert-butyl 4-[1-(4-amino-2-fluorophenyl)piperidin-4-yl]piperidine-1-carboxylate;ethane.
| Compound Name | tert-butyl 4-[1-(4-amino-2-fluorophenyl)piperidin-4-yl]piperidine-1-carboxylate;ethane |
|---|---|
| PubChem CID | 170749699 |
| Molecular Formula | C23H38FN3O2 |
| Molecular Weight | 407.57 g/mol |
| Exact Mass | 407.29 |
| IUPAC Name | tert-butyl 4-[1-(4-amino-2-fluorophenyl)piperidin-4-yl]piperidine-1-carboxylate;ethane |
| SMILES | CC.CC(C)(C)OC(=O)N1CCC(C2CCN(c3ccc(N)cc3F)CC2)CC1 |
| InChI | InChI=1S/C21H32FN3O2.C2H6/c1-21(2,3)27-20(26)25-12-8-16(9-13-25)15-6-10-24(11-7-15)19-5-4-17(23)14-18(19)22;1-2/h4-5,14-16H,6-13,23H2,1-3H3;1-2H3 |
| InChIKey | BMDPQGMWUSUHGL-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 58.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.57 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|