C22H30FN3O2 — CID 59178977
tert-butyl 4-[1-(2-fluoro-5-isocyanophenyl)piperidin-4-yl]piperidine-1-carboxylate (PubChem CID 59178977) has the molecular formula C22H30FN3O2 and a molecular weight of 387.50 g/mol. Its IUPAC name is tert-butyl 4-[1-(2-fluoro-5-isocyanophenyl)piperidin-4-yl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[1-(2-fluoro-5-isocyanophenyl)piperidin-4-yl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 59178977 |
| Molecular Formula | C22H30FN3O2 |
| Molecular Weight | 387.50 g/mol |
| Exact Mass | 387.23 |
| IUPAC Name | tert-butyl 4-[1-(2-fluoro-5-isocyanophenyl)piperidin-4-yl]piperidine-1-carboxylate |
| SMILES | [C-]#[N+]c1ccc(F)c(N2CCC(C3CCN(C(=O)OC(C)(C)C)CC3)CC2)c1 |
| InChI | InChI=1S/C22H30FN3O2/c1-22(2,3)28-21(27)26-13-9-17(10-14-26)16-7-11-25(12-8-16)20-15-18(24-4)5-6-19(20)23/h5-6,15-17H,7-14H2,1-3H3 |
| InChIKey | MWQYPXQYCPNQCW-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 37.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.50 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|