C22H33FN2O2 — CID 24961069
tert-butyl 4-[1-(2-fluoro-5-methylphenyl)piperidin-4-yl]piperidine-1-carboxylate (PubChem CID 24961069) has the molecular formula C22H33FN2O2 and a molecular weight of 376.52 g/mol. Its IUPAC name is tert-butyl 4-[1-(2-fluoro-5-methylphenyl)piperidin-4-yl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[1-(2-fluoro-5-methylphenyl)piperidin-4-yl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 24961069 |
| Molecular Formula | C22H33FN2O2 |
| Molecular Weight | 376.52 g/mol |
| Exact Mass | 376.25 |
| IUPAC Name | tert-butyl 4-[1-(2-fluoro-5-methylphenyl)piperidin-4-yl]piperidine-1-carboxylate |
| SMILES | Cc1ccc(F)c(N2CCC(C3CCN(C(=O)OC(C)(C)C)CC3)CC2)c1 |
| InChI | InChI=1S/C22H33FN2O2/c1-16-5-6-19(23)20(15-16)24-11-7-17(8-12-24)18-9-13-25(14-10-18)21(26)27-22(2,3)4/h5-6,15,17-18H,7-14H2,1-4H3 |
| InChIKey | ICUZFHXYBVEKHS-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.52 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |