C21H30ClFN2O2 — CID 24959231
tert-butyl 4-[1-(3-chloro-5-fluorophenyl)piperidin-4-yl]piperidine-1-carboxylate (PubChem CID 24959231) has the molecular formula C21H30ClFN2O2 and a molecular weight of 396.93 g/mol. Its IUPAC name is tert-butyl 4-[1-(3-chloro-5-fluorophenyl)piperidin-4-yl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[1-(3-chloro-5-fluorophenyl)piperidin-4-yl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 24959231 |
| Molecular Formula | C21H30ClFN2O2 |
| Molecular Weight | 396.93 g/mol |
| Exact Mass | 396.20 |
| IUPAC Name | tert-butyl 4-[1-(3-chloro-5-fluorophenyl)piperidin-4-yl]piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(C2CCN(c3cc(F)cc(Cl)c3)CC2)CC1 |
| InChI | InChI=1S/C21H30ClFN2O2/c1-21(2,3)27-20(26)25-10-6-16(7-11-25)15-4-8-24(9-5-15)19-13-17(22)12-18(23)14-19/h12-16H,4-11H2,1-3H3 |
| InChIKey | AJKYGOAQCCFDIM-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.93 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |