C23H37N3O4S — CID 59178971
tert-butyl 4-[1-[4-(dimethylsulfamoyl)phenyl]piperidin-4-yl]piperidine-1-carboxylate (PubChem CID 59178971) has the molecular formula C23H37N3O4S and a molecular weight of 451.63 g/mol. Its IUPAC name is tert-butyl 4-[1-[4-(dimethylsulfamoyl)phenyl]piperidin-4-yl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[1-[4-(dimethylsulfamoyl)phenyl]piperidin-4-yl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 59178971 |
| Molecular Formula | C23H37N3O4S |
| Molecular Weight | 451.63 g/mol |
| Exact Mass | 451.25 |
| IUPAC Name | tert-butyl 4-[1-[4-(dimethylsulfamoyl)phenyl]piperidin-4-yl]piperidine-1-carboxylate |
| SMILES | CN(C)S(=O)(=O)c1ccc(N2CCC(C3CCN(C(=O)OC(C)(C)C)CC3)CC2)cc1 |
| InChI | InChI=1S/C23H37N3O4S/c1-23(2,3)30-22(27)26-16-12-19(13-17-26)18-10-14-25(15-11-18)20-6-8-21(9-7-20)31(28,29)24(4)5/h6-9,18-19H,10-17H2,1-5H3 |
| InChIKey | SHVPABLFGWBKEC-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 70.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.63 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |