C22H33N3O5S — CID 139989216
tert-butyl 4-[4-(4-acetylpiperazin-1-yl)phenyl]sulfonylpiperidine-1-carboxylate (PubChem CID 139989216) has the molecular formula C22H33N3O5S and a molecular weight of 451.59 g/mol. Its IUPAC name is tert-butyl 4-[4-(4-acetylpiperazin-1-yl)phenyl]sulfonylpiperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[4-(4-acetylpiperazin-1-yl)phenyl]sulfonylpiperidine-1-carboxylate |
|---|---|
| PubChem CID | 139989216 |
| Molecular Formula | C22H33N3O5S |
| Molecular Weight | 451.59 g/mol |
| Exact Mass | 451.21 |
| IUPAC Name | tert-butyl 4-[4-(4-acetylpiperazin-1-yl)phenyl]sulfonylpiperidine-1-carboxylate |
| SMILES | CC(=O)N1CCN(c2ccc(S(=O)(=O)C3CCN(C(=O)OC(C)(C)C)CC3)cc2)CC1 |
| InChI | InChI=1S/C22H33N3O5S/c1-17(26)23-13-15-24(16-14-23)18-5-7-19(8-6-18)31(28,29)20-9-11-25(12-10-20)21(27)30-22(2,3)4/h5-8,20H,9-16H2,1-4H3 |
| InChIKey | CBAYOIJVJDFVPA-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 87.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.59 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |