C15H20FNO4S — CID 72660054
tert-butyl 3-(4-fluorophenyl)sulfonylpyrrolidine-1-carboxylate (PubChem CID 72660054) has the molecular formula C15H20FNO4S and a molecular weight of 329.39 g/mol. Its IUPAC name is tert-butyl 3-(4-fluorophenyl)sulfonylpyrrolidine-1-carboxylate.
| Compound Name | tert-butyl 3-(4-fluorophenyl)sulfonylpyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 72660054 |
| Molecular Formula | C15H20FNO4S |
| Molecular Weight | 329.39 g/mol |
| Exact Mass | 329.11 |
| IUPAC Name | tert-butyl 3-(4-fluorophenyl)sulfonylpyrrolidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(S(=O)(=O)c2ccc(F)cc2)C1 |
| InChI | InChI=1S/C15H20FNO4S/c1-15(2,3)21-14(18)17-9-8-13(10-17)22(19,20)12-6-4-11(16)5-7-12/h4-7,13H,8-10H2,1-3H3 |
| InChIKey | SRDWIHGJVMGGGW-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.39 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |