C14H21N3O4S — CID 71634218
tert-butyl (3R)-3-(3-methylpyrazin-2-yl)sulfonylpyrrolidine-1-carboxylate (PubChem CID 71634218) has the molecular formula C14H21N3O4S and a molecular weight of 327.41 g/mol. Its IUPAC name is tert-butyl (3R)-3-(3-methylpyrazin-2-yl)sulfonylpyrrolidine-1-carboxylate.
| Compound Name | tert-butyl (3R)-3-(3-methylpyrazin-2-yl)sulfonylpyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 71634218 |
| Molecular Formula | C14H21N3O4S |
| Molecular Weight | 327.41 g/mol |
| Exact Mass | 327.13 |
| IUPAC Name | tert-butyl (3R)-3-(3-methylpyrazin-2-yl)sulfonylpyrrolidine-1-carboxylate |
| SMILES | Cc1nccnc1S(=O)(=O)[C@@H]1CCN(C(=O)OC(C)(C)C)C1 |
| InChI | InChI=1S/C14H21N3O4S/c1-10-12(16-7-6-15-10)22(19,20)11-5-8-17(9-11)13(18)21-14(2,3)4/h6-7,11H,5,8-9H2,1-4H3/t11-/m1/s1 |
| InChIKey | JRIQHFIAIAHEJD-LLVKDONJSA-N |
| XLogP | 1.57 |
| TPSA | 89.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.41 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |