C15H23N3O4S — CID 97176154
tert-butyl (3S)-3-[(3-methylpyrazin-2-yl)sulfonylmethyl]pyrrolidine-1-carboxylate (PubChem CID 97176154) has the molecular formula C15H23N3O4S and a molecular weight of 341.43 g/mol. Its IUPAC name is tert-butyl (3S)-3-[(3-methylpyrazin-2-yl)sulfonylmethyl]pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl (3S)-3-[(3-methylpyrazin-2-yl)sulfonylmethyl]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 97176154 |
| Molecular Formula | C15H23N3O4S |
| Molecular Weight | 341.43 g/mol |
| Exact Mass | 341.14 |
| IUPAC Name | tert-butyl (3S)-3-[(3-methylpyrazin-2-yl)sulfonylmethyl]pyrrolidine-1-carboxylate |
| SMILES | Cc1nccnc1S(=O)(=O)C[C@H]1CCN(C(=O)OC(C)(C)C)C1 |
| InChI | InChI=1S/C15H23N3O4S/c1-11-13(17-7-6-16-11)23(20,21)10-12-5-8-18(9-12)14(19)22-15(2,3)4/h6-7,12H,5,8-10H2,1-4H3/t12-/m0/s1 |
| InChIKey | ABDRYDPCEBBXKS-LBPRGKRZSA-N |
| XLogP | 1.82 |
| TPSA | 89.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.43 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |