C16H24N2O4S — CID 97172498
tert-butyl (3S)-3-(pyridin-4-ylsulfonylmethyl)piperidine-1-carboxylate (PubChem CID 97172498) has the molecular formula C16H24N2O4S and a molecular weight of 340.44 g/mol. Its IUPAC name is tert-butyl (3S)-3-(pyridin-4-ylsulfonylmethyl)piperidine-1-carboxylate.
| Compound Name | tert-butyl (3S)-3-(pyridin-4-ylsulfonylmethyl)piperidine-1-carboxylate |
|---|---|
| PubChem CID | 97172498 |
| Molecular Formula | C16H24N2O4S |
| Molecular Weight | 340.44 g/mol |
| Exact Mass | 340.15 |
| IUPAC Name | tert-butyl (3S)-3-(pyridin-4-ylsulfonylmethyl)piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC[C@H](CS(=O)(=O)c2ccncc2)C1 |
| InChI | InChI=1S/C16H24N2O4S/c1-16(2,3)22-15(19)18-10-4-5-13(11-18)12-23(20,21)14-6-8-17-9-7-14/h6-9,13H,4-5,10-12H2,1-3H3/t13-/m0/s1 |
| InChIKey | JOTMRHBYCZMFOD-ZDUSSCGKSA-N |
| XLogP | 2.50 |
| TPSA | 76.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.44 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |