C17H26N2O3S — CID 97172646
tert-butyl (3S)-3-[[(R)-pyridin-4-ylmethylsulfinyl]methyl]piperidine-1-carboxylate (PubChem CID 97172646) has the molecular formula C17H26N2O3S and a molecular weight of 338.47 g/mol. Its IUPAC name is tert-butyl (3S)-3-[[(R)-pyridin-4-ylmethylsulfinyl]methyl]piperidine-1-carboxylate.
| Compound Name | tert-butyl (3S)-3-[[(R)-pyridin-4-ylmethylsulfinyl]methyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 97172646 |
| Molecular Formula | C17H26N2O3S |
| Molecular Weight | 338.47 g/mol |
| Exact Mass | 338.17 |
| IUPAC Name | tert-butyl (3S)-3-[[(R)-pyridin-4-ylmethylsulfinyl]methyl]piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC[C@H](C[S@@](=O)Cc2ccncc2)C1 |
| InChI | InChI=1S/C17H26N2O3S/c1-17(2,3)22-16(20)19-10-4-5-15(11-19)13-23(21)12-14-6-8-18-9-7-14/h6-9,15H,4-5,10-13H2,1-3H3/t15-,23-/m0/s1 |
| InChIKey | MGDVBYVJYYNNAA-WNSKOXEYSA-N |
| XLogP | 2.98 |
| TPSA | 59.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.47 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |