C17H24BrNO4S — CID 166001439
tert-butyl (3S)-3-[(3-bromophenyl)sulfonylmethyl]piperidine-1-carboxylate (PubChem CID 166001439) has the molecular formula C17H24BrNO4S and a molecular weight of 418.35 g/mol. Its IUPAC name is tert-butyl (3S)-3-[(3-bromophenyl)sulfonylmethyl]piperidine-1-carboxylate.
| Compound Name | tert-butyl (3S)-3-[(3-bromophenyl)sulfonylmethyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 166001439 |
| Molecular Formula | C17H24BrNO4S |
| Molecular Weight | 418.35 g/mol |
| Exact Mass | 417.06 |
| IUPAC Name | tert-butyl (3S)-3-[(3-bromophenyl)sulfonylmethyl]piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC[C@H](CS(=O)(=O)c2cccc(Br)c2)C1 |
| InChI | InChI=1S/C17H24BrNO4S/c1-17(2,3)23-16(20)19-9-5-6-13(11-19)12-24(21,22)15-8-4-7-14(18)10-15/h4,7-8,10,13H,5-6,9,11-12H2,1-3H3/t13-/m0/s1 |
| InChIKey | CPJAJDAKFMEFGP-ZDUSSCGKSA-N |
| XLogP | 3.87 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.35 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |