C17H24Br2N2O2 — CID 107597491
tert-butyl 3-[(2,6-dibromoanilino)methyl]piperidine-1-carboxylate (PubChem CID 107597491) has the molecular formula C17H24Br2N2O2 and a molecular weight of 448.20 g/mol. Its IUPAC name is tert-butyl 3-[(2,6-dibromoanilino)methyl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 3-[(2,6-dibromoanilino)methyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 107597491 |
| Molecular Formula | C17H24Br2N2O2 |
| Molecular Weight | 448.20 g/mol |
| Exact Mass | 446.02 |
| IUPAC Name | tert-butyl 3-[(2,6-dibromoanilino)methyl]piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCCC(CNc2c(Br)cccc2Br)C1 |
| InChI | InChI=1S/C17H24Br2N2O2/c1-17(2,3)23-16(22)21-9-5-6-12(11-21)10-20-15-13(18)7-4-8-14(15)19/h4,7-8,12,20H,5-6,9-11H2,1-3H3 |
| InChIKey | ZOENEXQPBLQAIZ-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.20 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |