C18H27N3O3 — CID 126811170
tert-butyl 3-[(4-carbamoylanilino)methyl]piperidine-1-carboxylate (PubChem CID 126811170) has the molecular formula C18H27N3O3 and a molecular weight of 333.43 g/mol. Its IUPAC name is tert-butyl 3-[(4-carbamoylanilino)methyl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 3-[(4-carbamoylanilino)methyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 126811170 |
| Molecular Formula | C18H27N3O3 |
| Molecular Weight | 333.43 g/mol |
| Exact Mass | 333.21 |
| IUPAC Name | tert-butyl 3-[(4-carbamoylanilino)methyl]piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCCC(CNc2ccc(C(N)=O)cc2)C1 |
| InChI | InChI=1S/C18H27N3O3/c1-18(2,3)24-17(23)21-10-4-5-13(12-21)11-20-15-8-6-14(7-9-15)16(19)22/h6-9,13,20H,4-5,10-12H2,1-3H3,(H2,19,22) |
| InChIKey | OXMWWRQHCXDKEH-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 84.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.43 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |