C21H28N2O3 — CID 168526338
tert-butyl 3-[[4-(furan-2-yl)anilino]methyl]piperidine-1-carboxylate (PubChem CID 168526338) has the molecular formula C21H28N2O3 and a molecular weight of 356.47 g/mol. Its IUPAC name is tert-butyl 3-[[4-(furan-2-yl)anilino]methyl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 3-[[4-(furan-2-yl)anilino]methyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 168526338 |
| Molecular Formula | C21H28N2O3 |
| Molecular Weight | 356.47 g/mol |
| Exact Mass | 356.21 |
| IUPAC Name | tert-butyl 3-[[4-(furan-2-yl)anilino]methyl]piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCCC(CNc2ccc(-c3ccco3)cc2)C1 |
| InChI | InChI=1S/C21H28N2O3/c1-21(2,3)26-20(24)23-12-4-6-16(15-23)14-22-18-10-8-17(9-11-18)19-7-5-13-25-19/h5,7-11,13,16,22H,4,6,12,14-15H2,1-3H3 |
| InChIKey | TVONDRLIXZFUSO-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 54.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.47 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |